C24H22N2O2S — CID 1245454
4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-(2-methylphenyl)benzamide (PubChem CID 1245454) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-(2-methylphenyl)benzamide.
| Compound Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 1245454 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-(2-methylphenyl)benzamide |
| SMILES | Cc1ccccc1NC(=O)c1ccc([C@H]2SCC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O2S/c1-17-7-5-6-10-21(17)25-23(28)19-11-13-20(14-12-19)24-26(22(27)16-29-24)15-18-8-3-2-4-9-18/h2-14,24H,15-16H2,1H3,(H,25,28)/t24-/m1/s1 |
| InChIKey | JLNXJCYGBBEATK-XMMPIXPASA-N |
| XLogP | 5.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |