C21H24N2O2S — CID 3139076
4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-(2-methylpropyl)benzamide (PubChem CID 3139076) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-(2-methylpropyl)benzamide.
| Compound Name | 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 3139076 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CNC(=O)c1ccc(C2SCC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N2O2S/c1-15(2)12-22-20(25)17-8-10-18(11-9-17)21-23(19(24)14-26-21)13-16-6-4-3-5-7-16/h3-11,15,21H,12-14H2,1-2H3,(H,22,25) |
| InChIKey | CEWUUPBXLZBWLL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |