C22H24N2O2S — CID 40560076
4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-cyclopentylbenzamide (PubChem CID 40560076) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-cyclopentylbenzamide.
| Compound Name | 4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-cyclopentylbenzamide |
|---|---|
| PubChem CID | 40560076 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-cyclopentylbenzamide |
| SMILES | O=C(NC1CCCC1)c1ccc([C@@H]2SCC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H24N2O2S/c25-20-15-27-22(24(20)14-16-6-2-1-3-7-16)18-12-10-17(11-13-18)21(26)23-19-8-4-5-9-19/h1-3,6-7,10-13,19,22H,4-5,8-9,14-15H2,(H,23,26)/t22-/m0/s1 |
| InChIKey | HTXCWCUGDCHDHB-QFIPXVFZSA-N |
| XLogP | 4.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |