C23H26N2O2S — CID 93486528
4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-cyclopentyl-N-methylbenzamide (PubChem CID 93486528) has the molecular formula C23H26N2O2S and a molecular weight of 394.54 g/mol. Its IUPAC name is 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-cyclopentyl-N-methylbenzamide.
| Compound Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-cyclopentyl-N-methylbenzamide |
|---|---|
| PubChem CID | 93486528 |
| Molecular Formula | C23H26N2O2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-cyclopentyl-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc([C@H]2SCC(=O)N2Cc2ccccc2)cc1)C1CCCC1 |
| InChI | InChI=1S/C23H26N2O2S/c1-24(20-9-5-6-10-20)22(27)18-11-13-19(14-12-18)23-25(21(26)16-28-23)15-17-7-3-2-4-8-17/h2-4,7-8,11-14,20,23H,5-6,9-10,15-16H2,1H3/t23-/m1/s1 |
| InChIKey | BXBLWVFBJVJQDT-HSZRJFAPSA-N |
| XLogP | 4.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |