C23H25N3O3S — CID 23939297
1-[4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoyl]piperidine-4-carboxamide (PubChem CID 23939297) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is 1-[4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 23939297 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 1-[4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)c2ccc(C3SCC(=O)N3Cc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H25N3O3S/c24-21(28)17-10-12-25(13-11-17)22(29)18-6-8-19(9-7-18)23-26(20(27)15-30-23)14-16-4-2-1-3-5-16/h1-9,17,23H,10-15H2,(H2,24,28) |
| InChIKey | CPRZSPJHALNCDN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |