C27H27N3O2S — CID 100500311
4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-(4-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 100500311) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-(4-pyrrolidin-1-ylphenyl)benzamide.
| Compound Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-(4-pyrrolidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 100500311 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-(4-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)c1ccc([C@H]2SCC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H27N3O2S/c31-25-19-33-27(30(25)18-20-6-2-1-3-7-20)22-10-8-21(9-11-22)26(32)28-23-12-14-24(15-13-23)29-16-4-5-17-29/h1-3,6-15,27H,4-5,16-19H2,(H,28,32)/t27-/m1/s1 |
| InChIKey | PGUQQCIGKQWRAJ-HHHXNRCGSA-N |
| XLogP | 5.31 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|