C24H20N2O4S — CID 1142825
N-(1,3-benzodioxol-5-yl)-4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]benzamide (PubChem CID 1142825) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]benzamide |
|---|---|
| PubChem CID | 1142825 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc([C@@H]2SCC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N2O4S/c27-22-14-31-24(26(22)13-16-4-2-1-3-5-16)18-8-6-17(7-9-18)23(28)25-19-10-11-20-21(12-19)30-15-29-20/h1-12,24H,13-15H2,(H,25,28)/t24-/m0/s1 |
| InChIKey | IAQWFMWTEKNXRW-DEOSSOPVSA-N |
| XLogP | 4.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |