C32H28N4O3S — CID 126191619
N-[(Z)-1-(4-benzamidophenyl)ethylideneamino]-4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]benzamide (PubChem CID 126191619) has the molecular formula C32H28N4O3S and a molecular weight of 548.67 g/mol. Its IUPAC name is N-[(Z)-1-(4-benzamidophenyl)ethylideneamino]-4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-benzamidophenyl)ethylideneamino]-4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]benzamide |
|---|---|
| PubChem CID | 126191619 |
| Molecular Formula | C32H28N4O3S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | N-[(Z)-1-(4-benzamidophenyl)ethylideneamino]-4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc([C@@H]2SCC(=O)N2Cc2ccccc2)cc1)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H28N4O3S/c1-22(24-16-18-28(19-17-24)33-30(38)25-10-6-3-7-11-25)34-35-31(39)26-12-14-27(15-13-26)32-36(29(37)21-40-32)20-23-8-4-2-5-9-23/h2-19,32H,20-21H2,1H3,(H,33,38)(H,35,39)/b34-22-/t32-/m0/s1 |
| InChIKey | KVTDOPSVMKQWQN-OKXFMPMSSA-N |
| XLogP | 5.87 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|