C33H34N2O2S — CID 126034356
N-[4-(1-adamantyl)phenyl]-4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]benzamide (PubChem CID 126034356) has the molecular formula C33H34N2O2S and a molecular weight of 522.71 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]benzamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]benzamide |
|---|---|
| PubChem CID | 126034356 |
| Molecular Formula | C33H34N2O2S |
| Molecular Weight | 522.71 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)c1ccc([C@H]2SCC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C33H34N2O2S/c36-30-21-38-32(35(30)20-22-4-2-1-3-5-22)27-8-6-26(7-9-27)31(37)34-29-12-10-28(11-13-29)33-17-23-14-24(18-33)16-25(15-23)19-33/h1-13,23-25,32H,14-21H2,(H,34,37)/t23?,24?,25?,32-,33?/m1/s1 |
| InChIKey | IRCOVTYVTKGJTL-KBKUVIOVSA-N |
| XLogP | 7.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.71 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |