C25H23N3O4S — CID 137077928
4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]benzamide (PubChem CID 137077928) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is 4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 137077928 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cccc(/C=N\NC(=O)c2ccc([C@@H]3SCC(=O)N3Cc3ccccc3)cc2)c1O |
| InChI | InChI=1S/C25H23N3O4S/c1-32-21-9-5-8-20(23(21)30)14-26-27-24(31)18-10-12-19(13-11-18)25-28(22(29)16-33-25)15-17-6-3-2-4-7-17/h2-14,25,30H,15-16H2,1H3,(H,27,31)/b26-14-/t25-/m0/s1 |
| InChIKey | OSNNFAVEELKZDX-VOOPIDQESA-N |
| XLogP | 3.94 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|