C30H27ClN4O2S — CID 98058410
4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide (PubChem CID 98058410) has the molecular formula C30H27ClN4O2S and a molecular weight of 543.09 g/mol. Its IUPAC name is 4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide.
| Compound Name | 4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 98058410 |
| Molecular Formula | C30H27ClN4O2S |
| Molecular Weight | 543.09 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 4-[(2S)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccc([C@@H]3SCC(=O)N3Cc3ccccc3)cc2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H27ClN4O2S/c1-20-16-25(21(2)35(20)27-14-12-26(31)13-15-27)17-32-33-29(37)23-8-10-24(11-9-23)30-34(28(36)19-38-30)18-22-6-4-3-5-7-22/h3-17,30H,18-19H2,1-2H3,(H,33,37)/b32-17-/t30-/m0/s1 |
| InChIKey | DFLQMWOUVRQPMS-LPZJPJBZSA-N |
| XLogP | 6.29 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.09 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|