C32H32N4O2S — CID 124539765
4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide (PubChem CID 124539765) has the molecular formula C32H32N4O2S and a molecular weight of 536.70 g/mol. Its IUPAC name is 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide.
| Compound Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 124539765 |
| Molecular Formula | C32H32N4O2S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1cccc(C)c1-n1c(C)cc(/C=N\NC(=O)c2ccc([C@H]3SCC(=O)N3Cc3ccccc3)cc2)c1C |
| InChI | InChI=1S/C32H32N4O2S/c1-21-9-8-10-22(2)30(21)36-23(3)17-28(24(36)4)18-33-34-31(38)26-13-15-27(16-14-26)32-35(29(37)20-39-32)19-25-11-6-5-7-12-25/h5-18,32H,19-20H2,1-4H3,(H,34,38)/b33-18-/t32-/m1/s1 |
| InChIKey | NRFYGQCOVVFONY-CWGMJEACSA-N |
| XLogP | 6.25 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|