C28H29N3O3S — CID 3813867
4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[[4-(2-methylpropoxy)phenyl]methylideneamino]benzamide (PubChem CID 3813867) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[[4-(2-methylpropoxy)phenyl]methylideneamino]benzamide.
| Compound Name | 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[[4-(2-methylpropoxy)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3813867 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[[4-(2-methylpropoxy)phenyl]methylideneamino]benzamide |
| SMILES | CC(C)COc1ccc(C=NNC(=O)c2ccc(C3SCC(=O)N3Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H29N3O3S/c1-20(2)18-34-25-14-8-21(9-15-25)16-29-30-27(33)23-10-12-24(13-11-23)28-31(26(32)19-35-28)17-22-6-4-3-5-7-22/h3-16,20,28H,17-19H2,1-2H3,(H,30,33) |
| InChIKey | ANXGDUMSYFYVHL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|