C31H26N4O5S — CID 124535004
4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 124535004) has the molecular formula C31H26N4O5S and a molecular weight of 566.64 g/mol. Its IUPAC name is 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 124535004 |
| Molecular Formula | C31H26N4O5S |
| Molecular Weight | 566.64 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(OCc2ccc([N+](=O)[O-])cc2)cc1)c1ccc([C@H]2SCC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H26N4O5S/c36-29-21-41-31(34(29)19-23-4-2-1-3-5-23)26-12-10-25(11-13-26)30(37)33-32-18-22-8-16-28(17-9-22)40-20-24-6-14-27(15-7-24)35(38)39/h1-18,31H,19-21H2,(H,33,37)/b32-18-/t31-/m1/s1 |
| InChIKey | XLPKYEJBXAIQBU-NSVDLNBOSA-N |
| XLogP | 5.71 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.64 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|