C26H25BrN4O2S — CID 3494602
4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]benzamide (PubChem CID 3494602) has the molecular formula C26H25BrN4O2S and a molecular weight of 537.48 g/mol. Its IUPAC name is 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]benzamide.
| Compound Name | 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3494602 |
| Molecular Formula | C26H25BrN4O2S |
| Molecular Weight | 537.48 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]benzamide |
| SMILES | CN(C)c1ccc(C=NNC(=O)c2ccc(C3SCC(=O)N3Cc3ccccc3)cc2)cc1Br |
| InChI | InChI=1S/C26H25BrN4O2S/c1-30(2)23-13-8-19(14-22(23)27)15-28-29-25(33)20-9-11-21(12-10-20)26-31(24(32)17-34-26)16-18-6-4-3-5-7-18/h3-15,26H,16-17H2,1-2H3,(H,29,33) |
| InChIKey | HLXUZKRIFBTHTN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|