C28H23ClN4O3S — CID 98103014
4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]benzamide (PubChem CID 98103014) has the molecular formula C28H23ClN4O3S and a molecular weight of 531.04 g/mol. Its IUPAC name is 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]benzamide.
| Compound Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 98103014 |
| Molecular Formula | C28H23ClN4O3S |
| Molecular Weight | 531.04 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]benzamide |
| SMILES | COc1ccc2cc(/C=N\NC(=O)c3ccc([C@H]4SCC(=O)N4Cc4ccccc4)cc3)c(Cl)nc2c1 |
| InChI | InChI=1S/C28H23ClN4O3S/c1-36-23-12-11-21-13-22(26(29)31-24(21)14-23)15-30-32-27(35)19-7-9-20(10-8-19)28-33(25(34)17-37-28)16-18-5-3-2-4-6-18/h2-15,28H,16-17H2,1H3,(H,32,35)/b30-15-/t28-/m1/s1 |
| InChIKey | WKWKWFDXLFCZRZ-KIXWIBQISA-N |
| XLogP | 5.43 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.04 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|