C26H26N2O3S — CID 46764264
4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[1-(4-methoxyphenyl)ethyl]benzamide (PubChem CID 46764264) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[1-(4-methoxyphenyl)ethyl]benzamide.
| Compound Name | 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[1-(4-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 46764264 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-[1-(4-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(C(C)NC(=O)c2ccc(C3SCC(=O)N3Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H26N2O3S/c1-18(20-12-14-23(31-2)15-13-20)27-25(30)21-8-10-22(11-9-21)26-28(24(29)17-32-26)16-19-6-4-3-5-7-19/h3-15,18,26H,16-17H2,1-2H3,(H,27,30) |
| InChIKey | KUCAVQAXCAVHNE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |