C26H26N2O2S — CID 21372044
4-[4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-yl]-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 21372044) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is 4-[4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-yl]-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 4-[4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-yl]-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 21372044 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4-[4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-yl]-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(C2SCC(=O)N2CCc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O2S/c1-19(21-10-6-3-7-11-21)27-25(30)22-12-14-23(15-13-22)26-28(24(29)18-31-26)17-16-20-8-4-2-5-9-20/h2-15,19,26H,16-18H2,1H3,(H,27,30)/t19-,26?/m0/s1 |
| InChIKey | RNVWCYNOEWJPIV-SXMXNQBWSA-N |
| XLogP | 4.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |