C28H25ClN4O2 — CID 3538909
N-[(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzamide (PubChem CID 3538909) has the molecular formula C28H25ClN4O2 and a molecular weight of 484.99 g/mol. Its IUPAC name is N-[(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzamide.
| Compound Name | N-[(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3538909 |
| Molecular Formula | C28H25ClN4O2 |
| Molecular Weight | 484.99 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | N-[(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzamide |
| SMILES | COc1ccc2cc(C=NNC(=O)c3ccc(CN4CCc5ccccc5C4)cc3)c(Cl)nc2c1 |
| InChI | InChI=1S/C28H25ClN4O2/c1-35-25-11-10-22-14-24(27(29)31-26(22)15-25)16-30-32-28(34)21-8-6-19(7-9-21)17-33-13-12-20-4-2-3-5-23(20)18-33/h2-11,14-16H,12-13,17-18H2,1H3,(H,32,34) |
| InChIKey | ABCKNLRVEOLVRE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.99 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|