C26H25N3O3 — CID 1249388
[4-[[[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzoyl]hydrazinylidene]methyl]phenyl] acetate (PubChem CID 1249388) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is [4-[[[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzoyl]hydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [4-[[[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzoyl]hydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 1249388 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | [4-[[[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzoyl]hydrazinylidene]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C=NNC(=O)c2ccc(CN3CCc4ccccc4C3)cc2)cc1 |
| InChI | InChI=1S/C26H25N3O3/c1-19(30)32-25-12-8-20(9-13-25)16-27-28-26(31)23-10-6-21(7-11-23)17-29-15-14-22-4-2-3-5-24(22)18-29/h2-13,16H,14-15,17-18H2,1H3,(H,28,31) |
| InChIKey | HGOMDOJMVCFEPY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|