C29H34N4O — CID 92662313
4-[(4-benzylpiperazin-1-yl)methyl]-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]benzamide (PubChem CID 92662313) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is 4-[(4-benzylpiperazin-1-yl)methyl]-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]benzamide.
| Compound Name | 4-[(4-benzylpiperazin-1-yl)methyl]-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 92662313 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 4-[(4-benzylpiperazin-1-yl)methyl]-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]benzamide |
| SMILES | CC(C)c1ccc(/C=N\NC(=O)c2ccc(CN3CCN(Cc4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H34N4O/c1-23(2)27-12-8-24(9-13-27)20-30-31-29(34)28-14-10-26(11-15-28)22-33-18-16-32(17-19-33)21-25-6-4-3-5-7-25/h3-15,20,23H,16-19,21-22H2,1-2H3,(H,31,34)/b30-20- |
| InChIKey | JELPCIOFUGPSQC-COEJQBHMSA-N |
| XLogP | 4.89 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|