C23H28BrN3O — CID 1272047
1-[(4-bromophenyl)methyl]-N-[(4-propan-2-ylphenyl)methylideneamino]piperidine-4-carboxamide (PubChem CID 1272047) has the molecular formula C23H28BrN3O and a molecular weight of 442.40 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-[(4-propan-2-ylphenyl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-[(4-propan-2-ylphenyl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1272047 |
| Molecular Formula | C23H28BrN3O |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-[(4-propan-2-ylphenyl)methylideneamino]piperidine-4-carboxamide |
| SMILES | CC(C)c1ccc(C=NNC(=O)C2CCN(Cc3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H28BrN3O/c1-17(2)20-7-3-18(4-8-20)15-25-26-23(28)21-11-13-27(14-12-21)16-19-5-9-22(24)10-6-19/h3-10,15,17,21H,11-14,16H2,1-2H3,(H,26,28) |
| InChIKey | RQRVJXMSVSOXRD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|