C23H29BrN3O+ — CID 6978967
1-[(4-bromophenyl)methyl]-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]piperidin-1-ium-4-carboxamide (PubChem CID 6978967) has the molecular formula C23H29BrN3O+ and a molecular weight of 443.41 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 6978967 |
| Molecular Formula | C23H29BrN3O+ |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]piperidin-1-ium-4-carboxamide |
| SMILES | CC(C)c1ccc(/C=N\NC(=O)C2CC[NH+](Cc3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H28BrN3O/c1-17(2)20-7-3-18(4-8-20)15-25-26-23(28)21-11-13-27(14-12-21)16-19-5-9-22(24)10-6-19/h3-10,15,17,21H,11-14,16H2,1-2H3,(H,26,28)/p+1/b25-15- |
| InChIKey | RQRVJXMSVSOXRD-MYYYXRDXSA-O |
| XLogP | 3.52 |
| TPSA | 45.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|