C20H22Cl2N3O+ — CID 7759240
1-[(4-chlorophenyl)methyl]-N-[(Z)-(4-chlorophenyl)methylideneamino]piperidin-1-ium-4-carboxamide (PubChem CID 7759240) has the molecular formula C20H22Cl2N3O+ and a molecular weight of 391.32 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-[(Z)-(4-chlorophenyl)methylideneamino]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-[(Z)-(4-chlorophenyl)methylideneamino]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7759240 |
| Molecular Formula | C20H22Cl2N3O+ |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-[(Z)-(4-chlorophenyl)methylideneamino]piperidin-1-ium-4-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)cc1)C1CC[NH+](Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H21Cl2N3O/c21-18-5-1-15(2-6-18)13-23-24-20(26)17-9-11-25(12-10-17)14-16-3-7-19(22)8-4-16/h1-8,13,17H,9-12,14H2,(H,24,26)/p+1/b23-13- |
| InChIKey | GYQQKMYWCLRVHF-QRVIBDJDSA-O |
| XLogP | 2.94 |
| TPSA | 45.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|