C20H23BrN3O2+ — CID 135765286
1-[(4-bromophenyl)methyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]piperidin-1-ium-4-carboxamide (PubChem CID 135765286) has the molecular formula C20H23BrN3O2+ and a molecular weight of 417.33 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 135765286 |
| Molecular Formula | C20H23BrN3O2+ |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]piperidin-1-ium-4-carboxamide |
| SMILES | O=C(N/N=C/c1ccccc1O)C1CC[NH+](Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H22BrN3O2/c21-18-7-5-15(6-8-18)14-24-11-9-16(10-12-24)20(26)23-22-13-17-3-1-2-4-19(17)25/h1-8,13,16,25H,9-12,14H2,(H,23,26)/p+1/b22-13+ |
| InChIKey | JEWDISBLGDANOT-LPYMAVHISA-O |
| XLogP | 2.10 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|