C20H23ClN3O2+ — CID 6978964
1-[(4-chlorophenyl)methyl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]piperidin-1-ium-4-carboxamide (PubChem CID 6978964) has the molecular formula C20H23ClN3O2+ and a molecular weight of 372.88 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 6978964 |
| Molecular Formula | C20H23ClN3O2+ |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]piperidin-1-ium-4-carboxamide |
| SMILES | O=C(N/N=C\c1cccc(O)c1)C1CC[NH+](Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H22ClN3O2/c21-18-6-4-15(5-7-18)14-24-10-8-17(9-11-24)20(26)23-22-13-16-2-1-3-19(25)12-16/h1-7,12-13,17,25H,8-11,14H2,(H,23,26)/p+1/b22-13- |
| InChIKey | YZVZTQDEYPGBMJ-XKZIYDEJSA-O |
| XLogP | 1.99 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|