C24H33ClN4O+2 — CID 7411859
N-[(Z)-(4-tert-butylphenyl)methylideneamino]-2-[4-[(4-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]acetamide (PubChem CID 7411859) has the molecular formula C24H33ClN4O+2 and a molecular weight of 429.01 g/mol. Its IUPAC name is N-[(Z)-(4-tert-butylphenyl)methylideneamino]-2-[4-[(4-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]acetamide.
| Compound Name | N-[(Z)-(4-tert-butylphenyl)methylideneamino]-2-[4-[(4-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]acetamide |
|---|---|
| PubChem CID | 7411859 |
| Molecular Formula | C24H33ClN4O+2 |
| Molecular Weight | 429.01 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-[(Z)-(4-tert-butylphenyl)methylideneamino]-2-[4-[(4-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]acetamide |
| SMILES | CC(C)(C)c1ccc(/C=N\NC(=O)C[NH+]2CC[NH+](Cc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H31ClN4O/c1-24(2,3)21-8-4-19(5-9-21)16-26-27-23(30)18-29-14-12-28(13-15-29)17-20-6-10-22(25)11-7-20/h4-11,16H,12-15,17-18H2,1-3H3,(H,27,30)/p+2/b26-16- |
| InChIKey | IZKBEJOBGRNTSN-QQXSKIMKSA-P |
| XLogP | 1.07 |
| TPSA | 50.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.01 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|