C20H19Cl2N3O2 — CID 126013246
1-(2-chlorobenzoyl)-N-[(Z)-(4-chlorophenyl)methylideneamino]piperidine-4-carboxamide (PubChem CID 126013246) has the molecular formula C20H19Cl2N3O2 and a molecular weight of 404.30 g/mol. Its IUPAC name is 1-(2-chlorobenzoyl)-N-[(Z)-(4-chlorophenyl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-(2-chlorobenzoyl)-N-[(Z)-(4-chlorophenyl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126013246 |
| Molecular Formula | C20H19Cl2N3O2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 1-(2-chlorobenzoyl)-N-[(Z)-(4-chlorophenyl)methylideneamino]piperidine-4-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)cc1)C1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H19Cl2N3O2/c21-16-7-5-14(6-8-16)13-23-24-19(26)15-9-11-25(12-10-15)20(27)17-3-1-2-4-18(17)22/h1-8,13,15H,9-12H2,(H,24,26)/b23-13- |
| InChIKey | QNARSYREHIBTFO-QRVIBDJDSA-N |
| XLogP | 4.00 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|