C20H17Cl4N3O2 — CID 126010821
1-(2,4-dichlorobenzoyl)-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]piperidine-4-carboxamide (PubChem CID 126010821) has the molecular formula C20H17Cl4N3O2 and a molecular weight of 473.19 g/mol. Its IUPAC name is 1-(2,4-dichlorobenzoyl)-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-(2,4-dichlorobenzoyl)-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126010821 |
| Molecular Formula | C20H17Cl4N3O2 |
| Molecular Weight | 473.19 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | 1-(2,4-dichlorobenzoyl)-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]piperidine-4-carboxamide |
| SMILES | O=C(N/N=C\c1cccc(Cl)c1Cl)C1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C20H17Cl4N3O2/c21-14-4-5-15(17(23)10-14)20(29)27-8-6-12(7-9-27)19(28)26-25-11-13-2-1-3-16(22)18(13)24/h1-5,10-12H,6-9H2,(H,26,28)/b25-11- |
| InChIKey | BEXSQDKELJVRTE-GATIEOLUSA-N |
| XLogP | 5.30 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.19 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|