C23H23Cl2N3O3 — CID 126013121
1-(2,4-dichlorobenzoyl)-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]piperidine-4-carboxamide (PubChem CID 126013121) has the molecular formula C23H23Cl2N3O3 and a molecular weight of 460.36 g/mol. Its IUPAC name is 1-(2,4-dichlorobenzoyl)-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-(2,4-dichlorobenzoyl)-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126013121 |
| Molecular Formula | C23H23Cl2N3O3 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 1-(2,4-dichlorobenzoyl)-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]piperidine-4-carboxamide |
| SMILES | C=CCOc1cccc(/C=N\NC(=O)C2CCN(C(=O)c3ccc(Cl)cc3Cl)CC2)c1 |
| InChI | InChI=1S/C23H23Cl2N3O3/c1-2-12-31-19-5-3-4-16(13-19)15-26-27-22(29)17-8-10-28(11-9-17)23(30)20-7-6-18(24)14-21(20)25/h2-7,13-15,17H,1,8-12H2,(H,27,29)/b26-15- |
| InChIKey | OKDKNTOLHBOVGK-YSMPRRRNSA-N |
| XLogP | 4.56 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|