C20H18Cl3N3O2 — CID 126014244
1-(2-chlorobenzoyl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]piperidine-4-carboxamide (PubChem CID 126014244) has the molecular formula C20H18Cl3N3O2 and a molecular weight of 438.74 g/mol. Its IUPAC name is 1-(2-chlorobenzoyl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-(2-chlorobenzoyl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126014244 |
| Molecular Formula | C20H18Cl3N3O2 |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 1-(2-chlorobenzoyl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]piperidine-4-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)cc1Cl)C1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H18Cl3N3O2/c21-15-6-5-14(18(23)11-15)12-24-25-19(27)13-7-9-26(10-8-13)20(28)16-3-1-2-4-17(16)22/h1-6,11-13H,7-10H2,(H,25,27)/b24-12- |
| InChIKey | YQYHGPXVWDTSFP-MSXFZWOLSA-N |
| XLogP | 4.65 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|