C20H20BrCl2N3O — CID 3647128
1-[(4-bromophenyl)methyl]-N-[(2,4-dichlorophenyl)methylideneamino]piperidine-4-carboxamide (PubChem CID 3647128) has the molecular formula C20H20BrCl2N3O and a molecular weight of 469.21 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-[(2,4-dichlorophenyl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-[(2,4-dichlorophenyl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3647128 |
| Molecular Formula | C20H20BrCl2N3O |
| Molecular Weight | 469.21 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-[(2,4-dichlorophenyl)methylideneamino]piperidine-4-carboxamide |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1Cl)C1CCN(Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H20BrCl2N3O/c21-17-4-1-14(2-5-17)13-26-9-7-15(8-10-26)20(27)25-24-12-16-3-6-18(22)11-19(16)23/h1-6,11-12,15H,7-10,13H2,(H,25,27) |
| InChIKey | MCGWVRFXSBDWHF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.21 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|