C20H21BrClN3O2 — CID 1273523
N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-1-[(4-chlorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 1273523) has the molecular formula C20H21BrClN3O2 and a molecular weight of 450.76 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-1-[(4-chlorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-1-[(4-chlorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1273523 |
| Molecular Formula | C20H21BrClN3O2 |
| Molecular Weight | 450.76 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-1-[(4-chlorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(NN=Cc1cc(Br)ccc1O)C1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H21BrClN3O2/c21-17-3-6-19(26)16(11-17)12-23-24-20(27)15-7-9-25(10-8-15)13-14-1-4-18(22)5-2-14/h1-6,11-12,15,26H,7-10,13H2,(H,24,27) |
| InChIKey | ZXUTYSGUAYGFFJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|