C19H21BrN4O — CID 1275412
1-[(4-bromophenyl)methyl]-N-(pyridin-4-ylmethylideneamino)piperidine-4-carboxamide (PubChem CID 1275412) has the molecular formula C19H21BrN4O and a molecular weight of 401.31 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-(pyridin-4-ylmethylideneamino)piperidine-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-(pyridin-4-ylmethylideneamino)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1275412 |
| Molecular Formula | C19H21BrN4O |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-(pyridin-4-ylmethylideneamino)piperidine-4-carboxamide |
| SMILES | O=C(NN=Cc1ccncc1)C1CCN(Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C19H21BrN4O/c20-18-3-1-16(2-4-18)14-24-11-7-17(8-12-24)19(25)23-22-13-15-5-9-21-10-6-15/h1-6,9-10,13,17H,7-8,11-12,14H2,(H,23,25) |
| InChIKey | BAFNNYGTZGAIJG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|