C21H24BrN3O3 — CID 136858153
1-[(4-bromophenyl)methyl]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]piperidine-4-carboxamide (PubChem CID 136858153) has the molecular formula C21H24BrN3O3 and a molecular weight of 446.35 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 136858153 |
| Molecular Formula | C21H24BrN3O3 |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]piperidine-4-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)C2CCN(Cc3ccc(Br)cc3)CC2)ccc1O |
| InChI | InChI=1S/C21H24BrN3O3/c1-28-20-12-16(4-7-19(20)26)13-23-24-21(27)17-8-10-25(11-9-17)14-15-2-5-18(22)6-3-15/h2-7,12-13,17,26H,8-11,14H2,1H3,(H,24,27)/b23-13- |
| InChIKey | MFJQDTLSAQRNFD-QRVIBDJDSA-N |
| XLogP | 3.53 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|