C21H23BrN4O5 — CID 3638414
1-[(4-bromophenyl)methyl]-N-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]piperidine-4-carboxamide (PubChem CID 3638414) has the molecular formula C21H23BrN4O5 and a molecular weight of 491.34 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3638414 |
| Molecular Formula | C21H23BrN4O5 |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]piperidine-4-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])cc(C=NNC(=O)C2CCN(Cc3ccc(Br)cc3)CC2)c1O |
| InChI | InChI=1S/C21H23BrN4O5/c1-31-19-11-18(26(29)30)10-16(20(19)27)12-23-24-21(28)15-6-8-25(9-7-15)13-14-2-4-17(22)5-3-14/h2-5,10-12,15,27H,6-9,13H2,1H3,(H,24,28) |
| InChIKey | BEKJXVWRDSNXRI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|