C20H20Br2N4O4 — CID 1275476
N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]piperidine-4-carboxamide (PubChem CID 1275476) has the molecular formula C20H20Br2N4O4 and a molecular weight of 540.21 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1275476 |
| Molecular Formula | C20H20Br2N4O4 |
| Molecular Weight | 540.21 g/mol |
| Exact Mass | 537.99 |
| IUPAC Name | N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(NN=Cc1cc(Br)cc(Br)c1O)C1CCN(Cc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C20H20Br2N4O4/c21-16-9-15(19(27)18(22)10-16)11-23-24-20(28)14-5-7-25(8-6-14)12-13-1-3-17(4-2-13)26(29)30/h1-4,9-11,14,27H,5-8,12H2,(H,24,28) |
| InChIKey | FYUNSXBPOSBOFI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|