C22H23Cl2N3O4 — CID 126013779
1-(2,4-dichlorobenzoyl)-N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]piperidine-4-carboxamide (PubChem CID 126013779) has the molecular formula C22H23Cl2N3O4 and a molecular weight of 464.35 g/mol. Its IUPAC name is 1-(2,4-dichlorobenzoyl)-N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-(2,4-dichlorobenzoyl)-N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126013779 |
| Molecular Formula | C22H23Cl2N3O4 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 1-(2,4-dichlorobenzoyl)-N-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]piperidine-4-carboxamide |
| SMILES | COc1cccc(/C=N\NC(=O)C2CCN(C(=O)c3ccc(Cl)cc3Cl)CC2)c1OC |
| InChI | InChI=1S/C22H23Cl2N3O4/c1-30-19-5-3-4-15(20(19)31-2)13-25-26-21(28)14-8-10-27(11-9-14)22(29)17-7-6-16(23)12-18(17)24/h3-7,12-14H,8-11H2,1-2H3,(H,26,28)/b25-13- |
| InChIKey | USJLNSDZJWUHDQ-MXAYSNPKSA-N |
| XLogP | 4.01 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|