C20H19BrClN3O2 — CID 126012715
N-[(Z)-(3-bromophenyl)methylideneamino]-1-(2-chlorobenzoyl)piperidine-4-carboxamide (PubChem CID 126012715) has the molecular formula C20H19BrClN3O2 and a molecular weight of 448.75 g/mol. Its IUPAC name is N-[(Z)-(3-bromophenyl)methylideneamino]-1-(2-chlorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-[(Z)-(3-bromophenyl)methylideneamino]-1-(2-chlorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126012715 |
| Molecular Formula | C20H19BrClN3O2 |
| Molecular Weight | 448.75 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | N-[(Z)-(3-bromophenyl)methylideneamino]-1-(2-chlorobenzoyl)piperidine-4-carboxamide |
| SMILES | O=C(N/N=C\c1cccc(Br)c1)C1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H19BrClN3O2/c21-16-5-3-4-14(12-16)13-23-24-19(26)15-8-10-25(11-9-15)20(27)17-6-1-2-7-18(17)22/h1-7,12-13,15H,8-11H2,(H,24,26)/b23-13- |
| InChIKey | MCXHNPUNXGMABH-QRVIBDJDSA-N |
| XLogP | 4.11 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.75 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|