C27H26ClN3O3 — CID 126014303
1-(2-chlorobenzoyl)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]piperidine-4-carboxamide (PubChem CID 126014303) has the molecular formula C27H26ClN3O3 and a molecular weight of 475.98 g/mol. Its IUPAC name is 1-(2-chlorobenzoyl)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-(2-chlorobenzoyl)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126014303 |
| Molecular Formula | C27H26ClN3O3 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 1-(2-chlorobenzoyl)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]piperidine-4-carboxamide |
| SMILES | O=C(N/N=C\c1cccc(OCc2ccccc2)c1)C1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C27H26ClN3O3/c28-25-12-5-4-11-24(25)27(33)31-15-13-22(14-16-31)26(32)30-29-18-21-9-6-10-23(17-21)34-19-20-7-2-1-3-8-20/h1-12,17-18,22H,13-16,19H2,(H,30,32)/b29-18- |
| InChIKey | ZBBSAJOOHGXKAH-MIXAMLLLSA-N |
| XLogP | 4.92 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|