C26H32ClN3O — CID 40822125
1-[(4-chlorophenyl)methyl]-N-[(Z)-[(Z)-2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]piperidine-4-carboxamide (PubChem CID 40822125) has the molecular formula C26H32ClN3O and a molecular weight of 438.02 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-[(Z)-[(Z)-2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]piperidine-4-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-[(Z)-[(Z)-2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 40822125 |
| Molecular Formula | C26H32ClN3O |
| Molecular Weight | 438.02 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-[(Z)-[(Z)-2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]piperidine-4-carboxamide |
| SMILES | CC(/C=N\NC(=O)C1CCN(Cc2ccc(Cl)cc2)CC1)=C/c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C26H32ClN3O/c1-19(2)23-8-4-21(5-9-23)16-20(3)17-28-29-26(31)24-12-14-30(15-13-24)18-22-6-10-25(27)11-7-22/h4-11,16-17,19,24H,12-15,18H2,1-3H3,(H,29,31)/b20-16-,28-17- |
| InChIKey | QCGRNECDTWJPKJ-XKSALVIMSA-N |
| XLogP | 5.88 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.02 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|