C23H27ClN4O — CID 6761601
2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-[(Z)-(2-methyl-3-phenylprop-2-enylidene)amino]acetamide (PubChem CID 6761601) has the molecular formula C23H27ClN4O and a molecular weight of 410.95 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-[(Z)-(2-methyl-3-phenylprop-2-enylidene)amino]acetamide.
| Compound Name | 2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-[(Z)-(2-methyl-3-phenylprop-2-enylidene)amino]acetamide |
|---|---|
| PubChem CID | 6761601 |
| Molecular Formula | C23H27ClN4O |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-[(Z)-(2-methyl-3-phenylprop-2-enylidene)amino]acetamide |
| SMILES | CC(=Cc1ccccc1)/C=N\NC(=O)CN1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H27ClN4O/c1-19(15-20-5-3-2-4-6-20)16-25-26-23(29)18-28-13-11-27(12-14-28)17-21-7-9-22(24)10-8-21/h2-10,15-16H,11-14,17-18H2,1H3,(H,26,29)/b19-15?,25-16- |
| InChIKey | RTKWUGJBKPIKNR-CZQAIAMLSA-N |
| XLogP | 3.66 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|