C20H22BrClN4O — CID 1386479
N-[(2-bromophenyl)methylideneamino]-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 1386479) has the molecular formula C20H22BrClN4O and a molecular weight of 449.78 g/mol. Its IUPAC name is N-[(2-bromophenyl)methylideneamino]-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[(2-bromophenyl)methylideneamino]-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 1386479 |
| Molecular Formula | C20H22BrClN4O |
| Molecular Weight | 449.78 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | N-[(2-bromophenyl)methylideneamino]-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(Cc2ccc(Cl)cc2)CC1)NN=Cc1ccccc1Br |
| InChI | InChI=1S/C20H22BrClN4O/c21-19-4-2-1-3-17(19)13-23-24-20(27)15-26-11-9-25(10-12-26)14-16-5-7-18(22)8-6-16/h1-8,13H,9-12,14-15H2,(H,24,27) |
| InChIKey | UTMRNFCBOBTQJT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|