C20H24N4OS — CID 137072839
2-(4-benzylpiperazin-1-yl)-N-[(2-sulfanylphenyl)methylideneamino]acetamide (PubChem CID 137072839) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-[(2-sulfanylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-[(2-sulfanylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137072839 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-[(2-sulfanylphenyl)methylideneamino]acetamide |
| SMILES | O=C(CN1CCN(Cc2ccccc2)CC1)NN=Cc1ccccc1S |
| InChI | InChI=1S/C20H24N4OS/c25-20(22-21-14-18-8-4-5-9-19(18)26)16-24-12-10-23(11-13-24)15-17-6-2-1-3-7-17/h1-9,14,26H,10-13,15-16H2,(H,22,25) |
| InChIKey | QMOGVOAPKPBASB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|