C20H25N5O — CID 123995368
N-[(2-aminophenyl)methylideneamino]-2-(4-benzylpiperazin-1-yl)acetamide (PubChem CID 123995368) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[(2-aminophenyl)methylideneamino]-2-(4-benzylpiperazin-1-yl)acetamide.
| Compound Name | N-[(2-aminophenyl)methylideneamino]-2-(4-benzylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 123995368 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | N-[(2-aminophenyl)methylideneamino]-2-(4-benzylpiperazin-1-yl)acetamide |
| SMILES | Nc1ccccc1C=NNC(=O)CN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H25N5O/c21-19-9-5-4-8-18(19)14-22-23-20(26)16-25-12-10-24(11-13-25)15-17-6-2-1-3-7-17/h1-9,14H,10-13,15-16,21H2,(H,23,26) |
| InChIKey | ILTWJVXIZAYHGT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|