C22H28N4O — CID 138741424
2-(4-benzylpiperazin-1-yl)-N-[(E)-(2,3-dimethylphenyl)methylideneamino]acetamide (PubChem CID 138741424) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-[(E)-(2,3-dimethylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-[(E)-(2,3-dimethylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 138741424 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-[(E)-(2,3-dimethylphenyl)methylideneamino]acetamide |
| SMILES | Cc1cccc(/C=N/NC(=O)CN2CCN(Cc3ccccc3)CC2)c1C |
| InChI | InChI=1S/C22H28N4O/c1-18-7-6-10-21(19(18)2)15-23-24-22(27)17-26-13-11-25(12-14-26)16-20-8-4-3-5-9-20/h3-10,15H,11-14,16-17H2,1-2H3,(H,24,27)/b23-15+ |
| InChIKey | CXQMASMHFOUNCE-HZHRSRAPSA-N |
| XLogP | 2.57 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|