C21H25ClN4O — CID 6887474
2-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-N-[(E)-(2-methylphenyl)methylideneamino]acetamide (PubChem CID 6887474) has the molecular formula C21H25ClN4O and a molecular weight of 384.91 g/mol. Its IUPAC name is 2-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-N-[(E)-(2-methylphenyl)methylideneamino]acetamide.
| Compound Name | 2-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-N-[(E)-(2-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6887474 |
| Molecular Formula | C21H25ClN4O |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-N-[(E)-(2-methylphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccccc1/C=N/NC(=O)CN1CCN(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H25ClN4O/c1-17-6-2-3-7-18(17)14-23-24-21(27)16-26-12-10-25(11-13-26)15-19-8-4-5-9-20(19)22/h2-9,14H,10-13,15-16H2,1H3,(H,24,27)/b23-14+ |
| InChIKey | IYINSLSNRCAZOW-OEAKJJBVSA-N |
| XLogP | 2.92 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|