C21H26N4O — CID 3714192
2-(4-benzylpiperazin-1-yl)-N-[(3-methylphenyl)methylideneamino]acetamide (PubChem CID 3714192) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-[(3-methylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-[(3-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3714192 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-[(3-methylphenyl)methylideneamino]acetamide |
| SMILES | Cc1cccc(C=NNC(=O)CN2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H26N4O/c1-18-6-5-9-20(14-18)15-22-23-21(26)17-25-12-10-24(11-13-25)16-19-7-3-2-4-8-19/h2-9,14-15H,10-13,16-17H2,1H3,(H,23,26) |
| InChIKey | WNLBFOQCEPFZJC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|