C20H22ClFN4O — CID 6868355
2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-[(E)-(4-fluorophenyl)methylideneamino]acetamide (PubChem CID 6868355) has the molecular formula C20H22ClFN4O and a molecular weight of 388.87 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-[(E)-(4-fluorophenyl)methylideneamino]acetamide.
| Compound Name | 2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-[(E)-(4-fluorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6868355 |
| Molecular Formula | C20H22ClFN4O |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-[(E)-(4-fluorophenyl)methylideneamino]acetamide |
| SMILES | O=C(CN1CCN(Cc2ccc(Cl)cc2)CC1)N/N=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22ClFN4O/c21-18-5-1-17(2-6-18)14-25-9-11-26(12-10-25)15-20(27)24-23-13-16-3-7-19(22)8-4-16/h1-8,13H,9-12,14-15H2,(H,24,27)/b23-13+ |
| InChIKey | UPVZEXDNSTWEOO-YDZHTSKRSA-N |
| XLogP | 2.75 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|