C20H21Cl2N5O3 — CID 6885934
N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 6885934) has the molecular formula C20H21Cl2N5O3 and a molecular weight of 450.33 g/mol. Its IUPAC name is N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 6885934 |
| Molecular Formula | C20H21Cl2N5O3 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(Cc2ccc(Cl)cc2)CC1)N/N=C/c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21Cl2N5O3/c21-17-4-1-15(2-5-17)13-25-7-9-26(10-8-25)14-20(28)24-23-12-16-3-6-18(22)19(11-16)27(29)30/h1-6,11-12H,7-10,13-14H2,(H,24,28)/b23-12+ |
| InChIKey | QZZDGCXIUCTWQT-FSJBWODESA-N |
| XLogP | 3.17 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|